NSC293827
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T16:10:11Z | |
dc.date.available | 2006-05-02T16:10:11Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T16:10:11Z | |
dc.identifier | NSC293827 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/161199 | |
dc.format.extent | 5750 bytes | |
dc.format.extent | 5473 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC293827 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | IUWLPMSAASBPIO-VLMOCZJJSA-N | |
dc.identifier.inchi | InChI=1S/C15H18Cl2O3/c1-6-8-4-5-15(3)9(12(8)20-14(6)19)7(2)11(18)10(16)13(15)17/h6,8,10,12-13H,4-5H2,1-3H3/t6-,8-,10-,12-,13+,15+/m0/s1 | |
dc.identifier.ichi | C15H18Cl2O3,1H3-6-7-13H-11H(10H(2H3)9(19)20-13)4H2-5H2-15(7,3H3)14H(17)12H(16)8(6)18 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules