NSC294906
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-02T16:38:19Z | |
dc.date.available | 2006-05-02T16:38:19Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-02T16:38:19Z | |
dc.identifier | NSC294906 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/161769 | |
dc.format.extent | 9334 bytes | |
dc.format.extent | 7734 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC294906 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | DALNGPVWDIIWJB-CHWSQXEVSA-N | |
dc.identifier.inchi | InChI=1S/C21H25N7O8/c22-21-26-17-16(19(34)27-21)28(9-15(31)32)12(8-24-17)7-23-11-3-1-10(2-4-11)18(33)25-13(20(35)36)5-6-14(29)30/h1-4,12-13,23H,5-9H2,(H,25,33)(H,29,30)(H,31,32)(H,35,36)(H4,22,24,26,27,34)/t12-,13-/m1/s1 | |
dc.identifier.ichi | C21H25N7O8,22H2-19-23-15-14(17(32)26H-19)28(7H2-13(30)35H)20H(9H2-25H-15)8H2-24H-11-3H-1H-10(2H-4H-11)16(31)27H-21H(18(33)36H)6H2-5H2-12(29)34H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules