NSC372226
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2006-05-05T14:13:40Z | |
dc.date.available | 2006-05-05T14:13:40Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2006-05-05T14:13:40Z | |
dc.identifier | NSC372226 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/180461 | |
dc.format.extent | 4405 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC372226 | en_GB |
dc.title.alternative | 5-Pyrimidinecarboxamide, 1,2,3,4-tetrahydro-6-hydroxy-2, 4-dioxo-N-phenyl-,cmpd with N,N-diethylethanamine (1:1) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | VKWYRWQIBQMDFJ-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C11H9N3O4/c15-8(12-6-4-2-1-3-5-6)7-9(16)13-11(18)14-10(7)17/h1-5H,(H,12,15)(H3,13,14,16,17,18) | |
dc.identifier.ichi | C11H9N3O4,15-8(12H-6-4H-2H-1H-3H-5H-6)7-9(16)13H-11(17)14H-10(7)18H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules