NSC1230
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-11-25T12:47:51Z | |
dc.date.available | 2004-11-25T12:47:51Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-11-25T12:47:51Z | |
dc.identifier | NSC1230 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/2767 | |
dc.format.extent | 3456 bytes | |
dc.format.extent | 3952 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC1230 | en_GB |
dc.title.alternative | Butanoic acid, 2-hydroxy-4-(methylthio)-, calcium salt (2:1) (9CI) | en_GB |
dc.title.alternative | Butyric acid, 2-hydroxy-4-(methylthio)-, calcium salt (2:1) (8CI) | en_GB |
dc.title.alternative | Calcium .alpha.-hydroxy-.gamma.-methylmercaptobutyrate (VAN) | en_GB |
dc.title.alternative | Methionine hydroxy analogue calcium salt | en_GB |
dc.title.alternative | OH-M | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | ONFOSYPQQXJWGS-BYPYZUCNSA-N | |
dc.identifier.inchi | InChI=1S/C5H10O3S/c1-9-3-2-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/t4-/m0/s1 | |
dc.identifier.ichi | C5H10O3S,1H3-9-3H2-2H2-5H(8H)4(6)7H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules