NSC1680
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-11-25T12:55:51Z | |
dc.date.available | 2004-11-25T12:55:51Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-11-25T12:55:51Z | |
dc.identifier | NSC1680 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/3186 | |
dc.format.extent | 12908 bytes | |
dc.format.extent | 10557 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC1680 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | OJVHDCHVHOISBO-ZEYPRKRQSA-N | |
dc.identifier.inchi | InChI=1S/C32H40O17S/c1-15(33)40-13-23-25(42-17(3)35)27(43-18(4)36)29(45-20(6)38)31(47-23)49-26-24(14-41-16(2)34)48-32(50-22-11-9-8-10-12-22)30(46-21(7)39)28(26)44-19(5)37/h8-12,23-32H,13-14H2,1-7H3/t23-,24-,25+,26+,27+,28+,29+,30+,31+,32-/m1/s1 | |
dc.identifier.ichi | C32H40O17S,1H3-15(33)40-13H2-23H-25H(42-17(3H3)35)27H(43-18(4H3)36)29H(45-20(6H3)38)31H(47-23)49-26H-24H(14H2-41-16(2H3)34)48-32H(50-22-11H-9H-8H-10H-12H-22)30H(46-21(7H3)39)28H(26)44-19(5H3)37 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules