NSC2838
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-12T17:43:04Z | |
dc.date.available | 2004-12-12T17:43:04Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-12T17:43:04Z | |
dc.identifier | NSC2838 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/4309 | |
dc.format.extent | 2695 bytes | |
dc.format.extent | 3426 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC2838 | en_GB |
dc.title.alternative | Benzo[b]thiophene, 2,3-dichloro- (8CI9CI) | en_GB |
dc.title.alternative | Thianaphthene, 2, 3-dichloro- | en_GB |
dc.title.alternative | WLN: T56 BSJ CG DG | en_GB |
dc.title.alternative | 1,2-Dichlorobenzo[b]thiophene | en_GB |
dc.title.alternative | 2, 3-Dichlorothianaphthene | en_GB |
dc.title.alternative | 2,3-Dichlorothionaphthene | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | ACKJNFZJNNOLCP-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C8H4Cl2S/c9-7-5-3-1-2-4-6(5)11-8(7)10/h1-4H | |
dc.identifier.ichi | C8H4Cl2S,9-7-5-3H-1H-2H-4H-6(5)11-8(7)10 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules