NSC3246
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2004-12-12T18:03:06Z | |
| dc.date.available | 2004-12-12T18:03:06Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2004-12-12T18:03:06Z | |
| dc.identifier | NSC3246 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/4691 | |
| dc.format.extent | 2317 bytes | |
| dc.format.extent | 2959 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC3246 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | FSQQTNAZHBEJLS-UPHRSURJSA-N | |
| dc.identifier.inchi | InChI=1S/C4H5NO3/c5-3(6)1-2-4(7)8/h1-2H,(H2,5,6)(H,7,8)/b2-1- | |
| dc.identifier.ichi | C4H5NO3,5H2-3(6)1H-2H-4(7)8H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules