NSC3847
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2004-12-12T18:16:46Z | |
| dc.date.available | 2004-12-12T18:16:46Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2004-12-12T18:16:46Z | |
| dc.identifier | NSC3847 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/5260 | |
| dc.format.extent | 2966 bytes | |
| dc.format.extent | 3551 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC3847 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | JDEVKENZHCONKI-UHFFFAOYSA-N | |
| dc.identifier.inchi | InChI=1S/C7H6BrNO3S/c1-2-5(10)6-3-4(9(11)12)7(8)13-6/h3H,2H2,1H3 | |
| dc.identifier.ichi | C7H6BrNO3S,1H3-3H2-6(10)5-2H-4(9(11)12)7(8)13-5 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules