NSC55881
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-22T17:24:20Z | |
dc.date.available | 2005-08-22T17:24:20Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-22T17:24:20Z | |
dc.identifier | NSC55881 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/53745 | |
dc.format.extent | 2496 bytes | |
dc.format.extent | 3155 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC55881 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | CFGQZVOVFIZRMN-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C6H6O3/c1-4-5(6(7)8)2-3-9-4/h2-3H,1H3,(H,7,8) | |
dc.identifier.ichi | C6H6O3,1H3-4-5(6(7)8H)2H-3H-9-4 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules