NSC60417
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T12:49:55Z | |
dc.date.available | 2005-08-23T12:49:55Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T12:49:55Z | |
dc.identifier | NSC60417 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/57054 | |
dc.format.extent | 4795 bytes | |
dc.format.extent | 4916 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC60417 | en_GB |
dc.title.alternative | Coumarin, 7-(allyloxy)-4,8-dimethyl- (8CI) | en_GB |
dc.title.alternative | 2H-1-Benzopyran-2-one, 4,8-dimethyl-7-(2-propenyloxy)- (9CI) | en_GB |
dc.title.alternative | 7-Allyloxy-4, 8-dimethylcoumarin | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | CWBNOQSQEHMTNZ-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C14H14O3/c1-4-7-16-12-6-5-11-9(2)8-13(15)17-14(11)10(12)3/h4-6,8H,1,7H2,2-3H3 | |
dc.identifier.ichi | C14H14O3,1H2-4H-8H2-16-12-6H-5H-11-9(2H3)7H-13(15)17-14(11)10(12)3H3 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules