NSC60430
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T12:50:39Z | |
dc.date.available | 2005-08-23T12:50:39Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T12:50:39Z | |
dc.identifier | NSC60430 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/57067 | |
dc.format.extent | 6967 bytes | |
dc.format.extent | 6330 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC60430 | en_GB |
dc.title.alternative | Butyric acid, 2-amino-4-(p-[bis(2-chloroethyl)amino]benzylthio)- | en_GB |
dc.title.alternative | Butyric acid, 2-amino-4-[[p-[bis(2-chloroethyl)amino]benzyl]thio]- | en_GB |
dc.title.alternative | L-Homocysteine, S-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]- | en_GB |
dc.title.alternative | MP 909 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | JIGGGKKAQQBEPX-CQSZACIVSA-N | |
dc.identifier.inchi | InChI=1S/C15H22Cl2N2O2S/c16-6-8-19(9-7-17)13-3-1-12(2-4-13)11-22-10-5-14(18)15(20)21/h1-4,14H,5-11,18H2,(H,20,21)/t14-/m1/s1 | |
dc.identifier.ichi | C15H22Cl2N2O2S,16-6H2-8H2-19(9H2-7H2-17)13-3H-1H-12(2H-4H-13)11H2-22-10H2-5H2-15H(18H2)14(20)21H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules