NSC60747
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T13:10:10Z | |
dc.date.available | 2005-08-23T13:10:10Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T13:10:10Z | |
dc.identifier | NSC60747 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/57376 | |
dc.format.extent | 10651 bytes | |
dc.format.extent | 8634 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC60747 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | SMWTYVQSFJLLCN-QODLHPCFSA-N | |
dc.identifier.inchi | InChI=1S/C33H27NO9/c35-29(22-13-5-1-6-14-22)39-21-26-27(41-30(36)23-15-7-2-8-16-23)28(42-31(37)24-17-9-3-10-18-24)32(40-26)43-33(38)34-25-19-11-4-12-20-25/h1-20,26-28,32H,21H2,(H,34,38)/t26-,27+,28+,32-/m1/s1 | |
dc.identifier.ichi | C33H27NO9,35-26(22-13H-5H-1H-6H-14H-22)39-21H2-30H-31H(40-27(36)23-15H-7H-2H-8H-16H-23)32H(41-28(37)24-17H-9H-3H-10H-18H-24)33H(43-30)42-29(38)34H-25-19H-11H-4H-12H-20H-25 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules