NSC4747
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T11:18:08Z | |
dc.date.available | 2004-12-13T11:18:08Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T11:18:08Z | |
dc.identifier | NSC4747 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/6118 | |
dc.format.extent | 3921 bytes | |
dc.format.extent | 4337 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC4747 | en_GB |
dc.title.alternative | N 244 | en_GB |
dc.title.alternative | Rhodanine, 3-(p-chlorophenyl)-5-methyl- (8CI) | en_GB |
dc.title.alternative | WLN: T5SYNV EHJ BUS CR DG& E1 | en_GB |
dc.title.alternative | 3-(p-Chlorophenyl)-5-methyl rhodanine | en_GB |
dc.title.alternative | 3-(p-Chlorophenyl)-5-methylrhodanine | en_GB |
dc.title.alternative | 4-Thiazolidinone, 3-(4-chlorophenyl)-5-methyl-2-thioxo- (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | IBWJXVVIEGGYGU-ZCFIWIBFSA-N | |
dc.identifier.inchi | InChI=1S/C10H8ClNOS2/c1-6-9(13)12(10(14)15-6)8-4-2-7(11)3-5-8/h2-6H,1H3/t6-/m1/s1 | |
dc.identifier.ichi | C10H8ClNOS2,1H3-10H-8(13)12(9(14)15-10)7-4H-2H-6(11)3H-5H-7 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules