NSC67583
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T18:35:28Z | |
dc.date.available | 2005-08-23T18:35:28Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T18:35:28Z | |
dc.identifier | NSC67583 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/61319 | |
dc.format.extent | 9151 bytes | |
dc.format.extent | 7791 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC67583 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | XVNNBSPKVRWTLT-XLXAGOSISA-N | |
dc.identifier.inchi | InChI=1S/C26H34O2/c1-25-12-10-20(27)16-19(25)8-9-21-22(25)11-13-26(2)23(21)15-18(24(26)28)14-17-6-4-3-5-7-17/h3-7,14,19-23,27H,8-13,15-16H2,1-2H3/b18-14+/t19-,20+,21+,22-,23-,25-,26-/m0/s1 | |
dc.identifier.ichi | C26H34O2,1H3-25-13H2-12H2-23H-22H(10H2-9H2-20H-16H2-21H(28H)11H2-14H2-26(20,23)2H3)24H(25)15H2-18(19(25)27)8H-17-6H-4H-3H-5H-7H-17 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules