NSC67957
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2005-08-23T18:56:01Z | |
| dc.date.available | 2005-08-23T18:56:01Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2005-08-23T18:56:01Z | |
| dc.identifier | NSC67957 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/61623 | |
| dc.format.extent | 2990 bytes | |
| dc.format.extent | 3521 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC67957 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | JRHWHSJDIILJAT-SCSAIBSYSA-N | |
| dc.identifier.inchi | InChI=1S/C5H10O3/c1-2-3-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/t4-/m1/s1 | |
| dc.identifier.ichi | C5H10O3,1H3-2H2-3H2-5H(8H)4(6)7H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules