NSC4848
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2004-12-13T11:20:50Z | |
| dc.date.available | 2004-12-13T11:20:50Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2004-12-13T11:20:50Z | |
| dc.identifier | NSC4848 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/6206 | |
| dc.format.extent | 1486 bytes | |
| dc.format.extent | 2484 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC4848 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | PBWZKZYHONABLN-UHFFFAOYSA-N | |
| dc.identifier.inchi | InChI=1S/C2H2F2O2/c3-1(4)2(5)6/h1H,(H,5,6) | |
| dc.identifier.ichi | C2H2F2O2,3-2H(4)1(5)6H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules