NSC69034
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T19:50:27Z | |
dc.date.available | 2005-08-23T19:50:27Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T19:50:27Z | |
dc.identifier | NSC69034 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/62334 | |
dc.format.extent | 5291 bytes | |
dc.format.extent | 4916 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC69034 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | UXMJWOYHJFYENL-HKHMFKSASA-N | |
dc.identifier.inchi | InChI=1S/C14H11ClN4O3/c15-13-11(8-16-19-14(13)22)18-17-10(6-7-12(20)21)9-4-2-1-3-5-9/h1-8H,(H,20,21)(H2,18,19,22)/b7-6+,17-10+ | |
dc.identifier.ichi | C14H11ClN4O3,15-13-11(8H-16-19H-14(13)21)18H-17-10(6H-7H-12(20)22H)9-4H-2H-1H-3H-5H-9 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules