NSC70174
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T20:37:54Z | |
dc.date.available | 2005-08-23T20:37:54Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T20:37:54Z | |
dc.identifier | NSC70174 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/63059 | |
dc.format.extent | 3946 bytes | |
dc.format.extent | 4221 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC70174 | en_GB |
dc.title.alternative | .alpha.-(4-Chlorophenoxy)propionic acid | en_GB |
dc.title.alternative | Propanoic acid, 2-(4-chlorophenoxy)- (9CI) | en_GB |
dc.title.alternative | Propionic acid, 2-(p-chlorophenoxy)- (8CI) | en_GB |
dc.title.alternative | 2-(p-Chlorophenoxy)propionic acid | en_GB |
dc.title.alternative | 2-(4-Chlorophenoxy)propionic acid | en_GB |
dc.title.alternative | 2-(4-CPP) | en_GB |
dc.title.alternative | 4-CPP | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | DKHJWWRYTONYHB-LURJTMIESA-N | |
dc.identifier.inchi | InChI=1S/C9H9ClO3/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6H,1H3,(H,11,12)/t6-/m0/s1 | |
dc.identifier.ichi | C9H9ClO3,1H3-9H(8(11)12H)13-7-4H-2H-6(10)3H-5H-7 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules