NSC70206
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T20:39:10Z | |
dc.date.available | 2005-08-23T20:39:10Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T20:39:10Z | |
dc.identifier | NSC70206 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/63085 | |
dc.format.extent | 4739 bytes | |
dc.format.extent | 4607 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC70206 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | NUUPKHHZJOCCDJ-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C15H12ClNO/c1-9(18)17-15-7-11-6-10-4-2-3-5-12(10)13(11)8-14(15)16/h2-5,7-8H,6H2,1H3,(H,17,18) | |
dc.identifier.ichi | C15H12ClNO,1H3-9(18)17H-15-6H-11-8H2-10-4H-2H-3H-5H-12(10)13(11)7H-14(15)16 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules