NSC70867
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2005-08-23T21:03:07Z | |
dc.date.available | 2005-08-23T21:03:07Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2005-08-23T21:03:07Z | |
dc.identifier | NSC70867 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/63497 | |
dc.format.extent | 2402 bytes | |
dc.format.extent | 3049 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC70867 | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | BFXWFQSYMVKOCJ-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C2H6N4O2/c3-1(5-7)2(4)6-8/h7-8H,(H2,3,5)(H2,4,6) | |
dc.identifier.ichi | C2H6N4O2,3H-1(5H-7H)2(4H)6H-8H | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules