NSC5949
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T12:10:09Z | |
dc.date.available | 2004-12-13T12:10:09Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T12:10:09Z | |
dc.identifier | NSC5949 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/7243 | |
dc.format.extent | 3632 bytes | |
dc.format.extent | 4129 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC5949 | en_GB |
dc.title.alternative | p-Methoxybenzyl alcohol, formate | en_GB |
dc.title.alternative | p-Methoxybenzyl formate | en_GB |
dc.title.alternative | Anisyl alcohol, formate | en_GB |
dc.title.alternative | Anisyl formate | en_GB |
dc.title.alternative | Benzenemethanol, 4-methoxy-, formate (9CI) | en_GB |
dc.title.alternative | Benzyl alcohol, p-methoxy-, formate (8CI) | en_GB |
dc.title.alternative | 4-Methoxybenzyl formate | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | XPDORSROGAZEGY-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C9H10O3/c1-11-9-4-2-8(3-5-9)6-12-7-10/h2-5,7H,6H2,1H3 | |
dc.identifier.ichi | C9H10O3,1H3-11-9-4H-2H-8(3H-5H-9)7H2-12-6H-10 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules