NSC6039
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T13:27:05Z | |
dc.date.available | 2004-12-13T13:27:05Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T13:27:05Z | |
dc.identifier | NSC6039 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/7331 | |
dc.format.extent | 5076 bytes | |
dc.format.extent | 5144 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC6039 | en_GB |
dc.title.alternative | Hydrocinnamyl isobutyrate | en_GB |
dc.title.alternative | Isobutyric acid, 3-phenylpropyl ester (8CI) | en_GB |
dc.title.alternative | Propanoic acid, 2-methyl-, 3-phenylpropyl ester (9CI) | en_GB |
dc.title.alternative | WLN: 1Y1&VO3R | en_GB |
dc.title.alternative | 3-Phenylpropyl isobutyrate | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | VBTAKMZSMFMLGT-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C13H18O2/c1-11(2)13(14)15-10-6-9-12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3 | |
dc.identifier.ichi | C13H18O2,1H3-13H(2H3)12(14)15-10H2-8H2-9H2-11-6H-4H-3H-5H-7H-11 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules