NSC6958
| dc.creator | US National Cancer Institute | en_GB |
| dc.date.accessioned | 2004-12-13T13:50:45Z | |
| dc.date.available | 2004-12-13T13:50:45Z | |
| dc.date.created | 2003-02-01 | en_GB |
| dc.date.issued | 2004-12-13T13:50:45Z | |
| dc.identifier | NSC6958 | en_GB |
| dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/8224 | |
| dc.format.extent | 3802 bytes | |
| dc.format.mimetype | chemical/x-cml | |
| dc.language.iso | en_GB | |
| dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
| dc.title | NSC6958 | en_GB |
| dc.type | Chemical Structures | en_GB |
| dc.identifier.inchikey | VGSUXRZWQGYSFH-UHFFFAOYSA-M | |
| dc.identifier.inchi | InChI=1S/C4H10O3P.C2H4O2.Hg/c1-3-6-8(5)7-4-2;1-2(3)4;/h3-4H2,1-2H3;1H3,(H,3,4);/q+1;;/p-1 | |
| dc.identifier.ichi | C6H13HgO5P,1H3-4H2-10-13(9,11-5H2-2H3)7-12-6(3H3)8 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules