NSC7510
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T14:37:58Z | |
dc.date.available | 2004-12-13T14:37:58Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T14:37:58Z | |
dc.identifier | NSC7510 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/8762 | |
dc.format.extent | 2336 bytes | |
dc.format.extent | 3161 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC7510 | en_GB |
dc.title.alternative | Thiazole, 2,4-dimethyl- (8CI9CI) | en_GB |
dc.title.alternative | WLN: T5N CSJ B1 E1 | en_GB |
dc.title.alternative | 2, 4-Dimethylthiazole | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | OBSLLHNATPQFMJ-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C5H7NS/c1-4-3-7-5(2)6-4/h3H,1-2H3 | |
dc.identifier.ichi | C5H7NS,1H3-4-3H-7-5(2H3)6-4 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules