NSC7562
dc.creator | US National Cancer Institute | en_GB |
dc.date.accessioned | 2004-12-13T14:39:27Z | |
dc.date.available | 2004-12-13T14:39:27Z | |
dc.date.created | 2003-02-01 | en_GB |
dc.date.issued | 2004-12-13T14:39:27Z | |
dc.identifier | NSC7562 | en_GB |
dc.identifier.uri | http://www.dspace.cam.ac.uk/handle/1810/8812 | |
dc.format.extent | 3936 bytes | |
dc.format.extent | 4260 bytes | |
dc.format.mimetype | chemical/x-cml | |
dc.format.mimetype | chemical/x-cml | |
dc.language.iso | en_GB | |
dc.publisher | Unilever Center for Molecular Informatics, Cambridge University | en_GB |
dc.title | NSC7562 | en_GB |
dc.title.alternative | 2-Pyrazolin-5-one, 1-(p-aminophenyl)-3-methyl- (8CI) | en_GB |
dc.title.alternative | 3H-Pyrazol-3-one, 2-(4-aminophenyl)-2,4-dihydro-5-methyl- (9CI) | en_GB |
dc.type | Chemical Structures | en_GB |
dc.identifier.inchikey | VNXUPEPDMYVBQY-UHFFFAOYSA-N | |
dc.identifier.inchi | InChI=1S/C10H11N3O/c1-7-6-10(14)13(12-7)9-4-2-8(11)3-5-9/h2-5H,6,11H2,1H3 | |
dc.identifier.ichi | C10H11N3O,1H3-7-6H2-10(14)13(12-7)9-4H-2H-8(11H2)3H-5H-9 | en_GB |
Files in this item
This item appears in the following Collection(s)
-
WWMM
The WorldWideMolecularMatrix, an Open collection of information on small molecules